C16H27N2+ — CID 6912278
1-[(1E,3E)-4-methyl-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine (PubChem CID 6912278) has the molecular formula C16H27N2+ and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-[(1E,3E)-4-methyl-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1E,3E)-4-methyl-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 6912278 |
| Molecular Formula | C16H27N2+ |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.22 |
| IUPAC Name | 1-[(1E,3E)-4-methyl-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine |
| SMILES | C/C(C=[N+]1CCCCC1)=C\C=C\N1CCCCC1 |
| InChI | InChI=1S/C16H27N2/c1-16(15-18-12-6-3-7-13-18)9-8-14-17-10-4-2-5-11-17/h8-9,14-15H,2-7,10-13H2,1H3/q+1 |
| InChIKey | DGXXNSJVNJOSJG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|