C15H25N2+ — CID 5475710
1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine (PubChem CID 5475710) has the molecular formula C15H25N2+ and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 5475710 |
| Molecular Formula | C15H25N2+ |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine |
| SMILES | C(/C=C/C=C/N1CCCCC1)=[N+]1CCCCC1 |
| InChI | InChI=1S/C15H25N2/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17/h3,8-9,14-15H,1-2,4-7,10-13H2/q+1 |
| InChIKey | GHJAWCTZTQSLLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|