C17H29N2+ — CID 6446701
4-methyl-1-[(1E,3E)-5-(4-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine (PubChem CID 6446701) has the molecular formula C17H29N2+ and a molecular weight of 261.43 g/mol. Its IUPAC name is 4-methyl-1-[(1E,3E)-5-(4-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine.
| Compound Name | 4-methyl-1-[(1E,3E)-5-(4-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 6446701 |
| Molecular Formula | C17H29N2+ |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | 4-methyl-1-[(1E,3E)-5-(4-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine |
| SMILES | CC1CCN(/C=C/C=C/C=[N+]2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C17H29N2/c1-16-6-12-18(13-7-16)10-4-3-5-11-19-14-8-17(2)9-15-19/h3-5,10-11,16-17H,6-9,12-15H2,1-2H3/q+1 |
| InChIKey | KDNBLBKYICFCLN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|