C18H33ClN2O — CID 21116656
3-methyl-1-[(1E,3E)-4-methyl-5-(3-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine;chloride;hydrate (PubChem CID 21116656) has the molecular formula C18H33ClN2O and a molecular weight of 328.93 g/mol. Its IUPAC name is 3-methyl-1-[(1E,3E)-4-methyl-5-(3-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine;chloride;hydrate.
| Compound Name | 3-methyl-1-[(1E,3E)-4-methyl-5-(3-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine;chloride;hydrate |
|---|---|
| PubChem CID | 21116656 |
| Molecular Formula | C18H33ClN2O |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-methyl-1-[(1E,3E)-4-methyl-5-(3-methylpiperidin-1-ium-1-ylidene)penta-1,3-dienyl]piperidine;chloride;hydrate |
| SMILES | CC(=C\C=C\N1CCCC(C)C1)/C=[N+]1\CCCC(C)C1.O.[Cl-] |
| InChI | InChI=1S/C18H31N2.ClH.H2O/c1-16-7-4-10-19(13-16)11-5-8-17(2)14-20-12-6-9-18(3)15-20;;/h5,8,11,14,16,18H,4,6-7,9-10,12-13,15H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | YXOCMTSCVDARQS-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 37.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|