C13H20N2O2 — CID 145198310
1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]piperidine-4-carboxylic acid (PubChem CID 145198310) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 145198310 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]piperidine-4-carboxylic acid |
| SMILES | C=C(/C=N/C(C)=C\C)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H20N2O2/c1-4-10(2)14-9-11(3)15-7-5-12(6-8-15)13(16)17/h4,9,12H,3,5-8H2,1-2H3,(H,16,17)/b10-4-,14-9+ |
| InChIKey | JZXVYDJRWCJDSN-JMFSVDGHSA-N |
| XLogP | 2.29 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|