C9H16N2O2 — CID 59639391
1-(C,N-dimethylcarbonimidoyl)piperidine-4-carboxylic acid (PubChem CID 59639391) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(C,N-dimethylcarbonimidoyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(C,N-dimethylcarbonimidoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 59639391 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-(C,N-dimethylcarbonimidoyl)piperidine-4-carboxylic acid |
| SMILES | C/N=C(\C)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C9H16N2O2/c1-7(10-2)11-5-3-8(4-6-11)9(12)13/h8H,3-6H2,1-2H3,(H,12,13)/b10-7+ |
| InChIKey | UGGYULTXQADYSK-JXMROGBWSA-N |
| XLogP | 0.83 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|