About (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne
(Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne (PubChem CID 145198326) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne.
Molecular Properties
| Compound Name | (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne |
| PubChem CID | 145198326 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne |
| SMILES | C#CC.CC/C=C(\C=N\C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C12H23N3.C3H4/c1-4-5-12(10-13-2)11-15-8-6-14(3)7-9-15;1-3-2/h5,10H,4,6-9,11H2,1-3H3;1H,2H3/b12-5+,13-10+; |
| InChIKey | HIZODPDUONEJIV-WMDDSLPESA-N |
| XLogP | 1.91 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne?
The IUPAC name of (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne (CID 145198326) is (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne.
What is the SMILES notation for (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne?
The canonical SMILES for (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne is C#CC.CC/C=C(\C=N\C)CN1CCN(C)CC1.
What is the InChIKey of (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne?
The InChIKey is HIZODPDUONEJIV-WMDDSLPESA-N. The full InChI is InChI=1S/C12H23N3.C3H4/c1-4-5-12(10-13-2)11-15-8-6-14(3)7-9-15;1-3-2/h5,10H,4,6-9,11H2,1-3H3;1H,2H3/b12-5+,13-10+;.
What are the key properties of (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne?
(Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne has a molecular weight of 249.40 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methyl-2-[(4-methylpiperazin-1-yl)methyl]pent-2-en-1-imine;prop-1-yne is sourced from PubChem (CID 145198326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).