C15H25N3 — CID 163535125
7-ethyl-3-[(4-methylpiperazin-1-yl)methyl]-2,5-dihydroazocine (PubChem CID 163535125) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 7-ethyl-3-[(4-methylpiperazin-1-yl)methyl]-2,5-dihydroazocine.
| Compound Name | 7-ethyl-3-[(4-methylpiperazin-1-yl)methyl]-2,5-dihydroazocine |
|---|---|
| PubChem CID | 163535125 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 7-ethyl-3-[(4-methylpiperazin-1-yl)methyl]-2,5-dihydroazocine |
| SMILES | CCC1=CCC=C(CN2CCN(C)CC2)C/N=C\1 |
| InChI | InChI=1S/C15H25N3/c1-3-14-5-4-6-15(12-16-11-14)13-18-9-7-17(2)8-10-18/h5-6,11H,3-4,7-10,12-13H2,1-2H3/b14-5?,15-6?,16-11- |
| InChIKey | DWGYQAWHFKXZFI-AJKGNHOZSA-N |
| XLogP | 1.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|