C14H27N3 — CID 145198370
ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 145198370) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylbut-2-en-1-imine.
| Compound Name | ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 145198370 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;(Z)-2-(piperazin-1-ylmethyl)-N-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C=C(C)/N=C/C(=C\C)CN1CCNCC1.CC |
| InChI | InChI=1S/C12H21N3.C2H6/c1-4-12(9-14-11(2)3)10-15-7-5-13-6-8-15;1-2/h4,9,13H,2,5-8,10H2,1,3H3;1-2H3/b12-4+,14-9+; |
| InChIKey | KMGOUEBMVUPHBY-LTBKCWHXSA-N |
| XLogP | 2.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|