C13H25N3 — CID 134406419
N-ethyl-N'-methyl-N'-[(Z)-2-(prop-1-en-2-yliminomethyl)but-2-enyl]ethane-1,2-diamine (PubChem CID 134406419) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(Z)-2-(prop-1-en-2-yliminomethyl)but-2-enyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[(Z)-2-(prop-1-en-2-yliminomethyl)but-2-enyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134406419 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(Z)-2-(prop-1-en-2-yliminomethyl)but-2-enyl]ethane-1,2-diamine |
| SMILES | C=C(C)/N=C/C(=C\C)CN(C)CCNCC |
| InChI | InChI=1S/C13H25N3/c1-6-13(10-15-12(3)4)11-16(5)9-8-14-7-2/h6,10,14H,3,7-9,11H2,1-2,4-5H3/b13-6+,15-10+ |
| InChIKey | NHPYMYMQAFQVAM-ADEQXRJWSA-N |
| XLogP | 2.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|