C12H24N3+ — CID 123243465
trimethyl-[2-[(3-methyl-5-methyliminopenta-1,3-dien-2-yl)amino]ethyl]azanium (PubChem CID 123243465) has the molecular formula C12H24N3+ and a molecular weight of 210.34 g/mol. Its IUPAC name is trimethyl-[2-[(3-methyl-5-methyliminopenta-1,3-dien-2-yl)amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[(3-methyl-5-methyliminopenta-1,3-dien-2-yl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 123243465 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | trimethyl-[2-[(3-methyl-5-methyliminopenta-1,3-dien-2-yl)amino]ethyl]azanium |
| SMILES | C=C(NCC[N+](C)(C)C)C(C)=C/C=N/C |
| InChI | InChI=1S/C12H24N3/c1-11(7-8-13-3)12(2)14-9-10-15(4,5)6/h7-8,14H,2,9-10H2,1,3-6H3/q+1/b11-7?,13-8+ |
| InChIKey | UNPJXKNRVVBKQR-HQGKJDKDSA-N |
| XLogP | 1.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|