C10H17N3 — CID 130338658
(3E)-4-N-ethenyl-5-(ethylideneamino)-3-methylpenta-1,3-diene-2,4-diamine (PubChem CID 130338658) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (3E)-4-N-ethenyl-5-(ethylideneamino)-3-methylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3E)-4-N-ethenyl-5-(ethylideneamino)-3-methylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 130338658 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (3E)-4-N-ethenyl-5-(ethylideneamino)-3-methylpenta-1,3-diene-2,4-diamine |
| SMILES | C=CN/C(C/N=C/C)=C(\C)C(=C)N |
| InChI | InChI=1S/C10H17N3/c1-5-12-7-10(13-6-2)8(3)9(4)11/h5-6,13H,2,4,7,11H2,1,3H3/b10-8+,12-5+ |
| InChIKey | AIDGNNVSEHIZAV-ZROACKIGSA-N |
| XLogP | 1.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|