C14H24N2 — CID 130370752
N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-N',N'-diethylethane-1,2-diamine (PubChem CID 130370752) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130370752 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]-N',N'-diethylethane-1,2-diamine |
| SMILES | C=C/C=C(\C=C)C(=C)NCCN(CC)CC |
| InChI | InChI=1S/C14H24N2/c1-6-10-14(7-2)13(5)15-11-12-16(8-3)9-4/h6-7,10,15H,1-2,5,8-9,11-12H2,3-4H3/b14-10+ |
| InChIKey | HDXZWLILDDRLEI-GXDHUFHOSA-N |
| XLogP | 2.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|