C9H17FN2 — CID 174289613
N'-[(2E,4Z)-6-fluoro-5-methylhexa-2,4-dien-3-yl]ethane-1,2-diamine (PubChem CID 174289613) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is N'-[(2E,4Z)-6-fluoro-5-methylhexa-2,4-dien-3-yl]ethane-1,2-diamine.
| Compound Name | N'-[(2E,4Z)-6-fluoro-5-methylhexa-2,4-dien-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 174289613 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | N'-[(2E,4Z)-6-fluoro-5-methylhexa-2,4-dien-3-yl]ethane-1,2-diamine |
| SMILES | C/C=C(\C=C(\C)CF)NCCN |
| InChI | InChI=1S/C9H17FN2/c1-3-9(12-5-4-11)6-8(2)7-10/h3,6,12H,4-5,7,11H2,1-2H3/b8-6-,9-3+ |
| InChIKey | CMNXQOUBAVLHPJ-FTYJLKAESA-N |
| XLogP | 1.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|