C9H15F2N3 — CID 144968356
(3Z,5Z)-2-N-(2,2-difluoroethyl)hepta-1,3,5-triene-2,3,6-triamine (PubChem CID 144968356) has the molecular formula C9H15F2N3 and a molecular weight of 203.24 g/mol. Its IUPAC name is (3Z,5Z)-2-N-(2,2-difluoroethyl)hepta-1,3,5-triene-2,3,6-triamine.
| Compound Name | (3Z,5Z)-2-N-(2,2-difluoroethyl)hepta-1,3,5-triene-2,3,6-triamine |
|---|---|
| PubChem CID | 144968356 |
| Molecular Formula | C9H15F2N3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (3Z,5Z)-2-N-(2,2-difluoroethyl)hepta-1,3,5-triene-2,3,6-triamine |
| SMILES | C=C(NCC(F)F)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C9H15F2N3/c1-6(12)3-4-8(13)7(2)14-5-9(10)11/h3-4,9,14H,2,5,12-13H2,1H3/b6-3-,8-4- |
| InChIKey | RYVKJSVHQQNCTK-IJXUMNLFSA-N |
| XLogP | 1.06 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|