C8H12F2N2 — CID 142348649
(3Z)-5-N-ethyl-3,4-difluorohexa-1,3,5-triene-2,5-diamine (PubChem CID 142348649) has the molecular formula C8H12F2N2 and a molecular weight of 174.19 g/mol. Its IUPAC name is (3Z)-5-N-ethyl-3,4-difluorohexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-5-N-ethyl-3,4-difluorohexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 142348649 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3Z)-5-N-ethyl-3,4-difluorohexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(N)/C(F)=C(/F)C(=C)NCC |
| InChI | InChI=1S/C8H12F2N2/c1-4-12-6(3)8(10)7(9)5(2)11/h12H,2-4,11H2,1H3/b8-7- |
| InChIKey | HKCQBZUFUSXEGH-FPLPWBNLSA-N |
| XLogP | 1.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|