C13H18N2 — CID 126695578
(2E,4Z)-N-[2-(prop-2-enylideneamino)prop-2-enyl]hepta-2,4,6-trien-3-amine (PubChem CID 126695578) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2E,4Z)-N-[2-(prop-2-enylideneamino)prop-2-enyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-[2-(prop-2-enylideneamino)prop-2-enyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 126695578 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (2E,4Z)-N-[2-(prop-2-enylideneamino)prop-2-enyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C\C(=C/C)NCC(=C)/N=C/C=C |
| InChI | InChI=1S/C13H18N2/c1-5-8-9-13(7-3)15-11-12(4)14-10-6-2/h5-10,15H,1-2,4,11H2,3H3/b9-8-,13-7+,14-10+ |
| InChIKey | LWODUVPTRLKTBU-FDELCXDJSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|