C9H16N2 — CID 89339501
(2E,4Z)-1-N-prop-1-en-2-ylhexa-2,4-diene-1,2-diamine (PubChem CID 89339501) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4Z)-1-N-prop-1-en-2-ylhexa-2,4-diene-1,2-diamine.
| Compound Name | (2E,4Z)-1-N-prop-1-en-2-ylhexa-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 89339501 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2E,4Z)-1-N-prop-1-en-2-ylhexa-2,4-diene-1,2-diamine |
| SMILES | C=C(C)NC/C(N)=C\C=C/C |
| InChI | InChI=1S/C9H16N2/c1-4-5-6-9(10)7-11-8(2)3/h4-6,11H,2,7,10H2,1,3H3/b5-4-,9-6+ |
| InChIKey | HNYLRJUZEPOILT-KMOPYBJPSA-N |
| XLogP | 1.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|