C11H21FN2 — CID 166785642
N'-butan-2-yl-N'-[(3Z)-5-fluoropenta-1,3-dien-2-yl]ethane-1,2-diamine (PubChem CID 166785642) has the molecular formula C11H21FN2 and a molecular weight of 200.30 g/mol. Its IUPAC name is N'-butan-2-yl-N'-[(3Z)-5-fluoropenta-1,3-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N'-[(3Z)-5-fluoropenta-1,3-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166785642 |
| Molecular Formula | C11H21FN2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | N'-butan-2-yl-N'-[(3Z)-5-fluoropenta-1,3-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(/C=C\CF)N(CCN)C(C)CC |
| InChI | InChI=1S/C11H21FN2/c1-4-10(2)14(9-8-13)11(3)6-5-7-12/h5-6,10H,3-4,7-9,13H2,1-2H3/b6-5- |
| InChIKey | XLBUEFSKZUIWBP-WAYWQWQTSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|