C12H21FN2 — CID 143287780
N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 143287780) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143287780 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | N'-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C(F)/C=C\C(=C/C)N(C)CCN(C)C |
| InChI | InChI=1S/C12H21FN2/c1-6-12(8-7-11(2)13)15(5)10-9-14(3)4/h6-8H,2,9-10H2,1,3-5H3/b8-7-,12-6+ |
| InChIKey | GASGOGCXZCSLCG-HRZQEMGZSA-N |
| XLogP | 2.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|