C11H20N2 — CID 123662048
N,N'-dimethyl-N'-(3-methylhexa-1,3,5-trien-2-yl)ethane-1,2-diamine (PubChem CID 123662048) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(3-methylhexa-1,3,5-trien-2-yl)ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N'-(3-methylhexa-1,3,5-trien-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123662048 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,N'-dimethyl-N'-(3-methylhexa-1,3,5-trien-2-yl)ethane-1,2-diamine |
| SMILES | C=CC=C(C)C(=C)N(C)CCNC |
| InChI | InChI=1S/C11H20N2/c1-6-7-10(2)11(3)13(5)9-8-12-4/h6-7,12H,1,3,8-9H2,2,4-5H3 |
| InChIKey | HRJFMPUEJBCWTN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|