C14H26N3+ — CID 123374901
3-methyl-5-methylimino-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]penta-1,3-dien-2-amine (PubChem CID 123374901) has the molecular formula C14H26N3+ and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-methyl-5-methylimino-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]penta-1,3-dien-2-amine.
| Compound Name | 3-methyl-5-methylimino-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 123374901 |
| Molecular Formula | C14H26N3+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 3-methyl-5-methylimino-N-[2-(1-methylpyrrolidin-1-ium-1-yl)ethyl]penta-1,3-dien-2-amine |
| SMILES | C=C(NCC[N+]1(C)CCCC1)C(C)=C/C=N/C |
| InChI | InChI=1S/C14H26N3/c1-13(7-8-15-3)14(2)16-9-12-17(4)10-5-6-11-17/h7-8,16H,2,5-6,9-12H2,1,3-4H3/q+1/b13-7?,15-8+ |
| InChIKey | GGSKXRKCECZLKQ-GBSXSVLBSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|