C15H27N3 — CID 156743896
(3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine (PubChem CID 156743896) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine.
| Compound Name | (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 156743896 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine |
| SMILES | C=C(/C=C(C)/N=C/C)NCCN1CCCC1(C)C |
| InChI | InChI=1S/C15H27N3/c1-6-16-13(2)12-14(3)17-9-11-18-10-7-8-15(18,4)5/h6,12,17H,3,7-11H2,1-2,4-5H3/b13-12+,16-6+ |
| InChIKey | ZITDQJOQIADEBG-NPJPPYHVSA-N |
| XLogP | 2.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|