C19H39N3 — CID 156743895
(3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine;ethane (PubChem CID 156743895) has the molecular formula C19H39N3 and a molecular weight of 309.54 g/mol. Its IUPAC name is (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine;ethane.
| Compound Name | (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine;ethane |
|---|---|
| PubChem CID | 156743895 |
| Molecular Formula | C19H39N3 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.31 |
| IUPAC Name | (3E)-N-[2-(2,2-dimethylpyrrolidin-1-yl)ethyl]-4-(ethylideneamino)penta-1,3-dien-2-amine;ethane |
| SMILES | C=C(/C=C(C)/N=C/C)NCCN1CCCC1(C)C.CC.CC |
| InChI | InChI=1S/C15H27N3.2C2H6/c1-6-16-13(2)12-14(3)17-9-11-18-10-7-8-15(18,4)5;2*1-2/h6,12,17H,3,7-11H2,1-2,4-5H3;2*1-2H3/b13-12+,16-6+;; |
| InChIKey | RNCDCMDEOQENPE-JOYNWSMSSA-N |
| XLogP | 5.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|