C15H28N4 — CID 168890475
ethane;(E)-2-methanimidoyl-3-[(3Z)-2-(propylamino)penta-1,3-dien-3-yl]iminobut-1-en-1-amine (PubChem CID 168890475) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is ethane;(E)-2-methanimidoyl-3-[(3Z)-2-(propylamino)penta-1,3-dien-3-yl]iminobut-1-en-1-amine.
| Compound Name | ethane;(E)-2-methanimidoyl-3-[(3Z)-2-(propylamino)penta-1,3-dien-3-yl]iminobut-1-en-1-amine |
|---|---|
| PubChem CID | 168890475 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | ethane;(E)-2-methanimidoyl-3-[(3Z)-2-(propylamino)penta-1,3-dien-3-yl]iminobut-1-en-1-amine |
| SMILES | CC.[H]/N=C/C(=C\N)/C(C)=N/C(=C\C)C(=C)NCCC |
| InChI | InChI=1S/C13H22N4.C2H6/c1-5-7-16-11(4)13(6-2)17-10(3)12(8-14)9-15;1-2/h6,8-9,14,16H,4-5,7,15H2,1-3H3;1-2H3/b12-9+,13-6-,14-8+,17-10+; |
| InChIKey | ICEFRNOCBGLWOJ-KQDNJSCBSA-N |
| XLogP | 3.38 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|