C12H23N3 — CID 134405858
N-ethyl-N'-methyl-N'-[(E)-1-prop-1-en-2-yliminobut-2-en-2-yl]ethane-1,2-diamine (PubChem CID 134405858) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(E)-1-prop-1-en-2-yliminobut-2-en-2-yl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[(E)-1-prop-1-en-2-yliminobut-2-en-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134405858 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(E)-1-prop-1-en-2-yliminobut-2-en-2-yl]ethane-1,2-diamine |
| SMILES | C=C(C)/N=C/C(=C\C)N(C)CCNCC |
| InChI | InChI=1S/C12H23N3/c1-6-12(10-14-11(3)4)15(5)9-8-13-7-2/h6,10,13H,3,7-9H2,1-2,4-5H3/b12-6+,14-10+ |
| InChIKey | MGFNNPKKLLPZIV-WMWBVCCJSA-N |
| XLogP | 2.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|