C11H27N5 — CID 166924178
1-N-(2-aminoethyl)-1-N-[2-[2-(ethylamino)ethylamino]ethyl]prop-2-ene-1,2-diamine (PubChem CID 166924178) has the molecular formula C11H27N5 and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-1-N-[2-[2-(ethylamino)ethylamino]ethyl]prop-2-ene-1,2-diamine.
| Compound Name | 1-N-(2-aminoethyl)-1-N-[2-[2-(ethylamino)ethylamino]ethyl]prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 166924178 |
| Molecular Formula | C11H27N5 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.23 |
| IUPAC Name | 1-N-(2-aminoethyl)-1-N-[2-[2-(ethylamino)ethylamino]ethyl]prop-2-ene-1,2-diamine |
| SMILES | C=C(N)CN(CCN)CCNCCNCC |
| InChI | InChI=1S/C11H27N5/c1-3-14-5-6-15-7-9-16(8-4-12)10-11(2)13/h14-15H,2-10,12-13H2,1H3 |
| InChIKey | PDJUHKMBWODLJZ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|