C16H31N3 — CID 145198389
ethane;N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine (PubChem CID 145198389) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine.
| Compound Name | ethane;N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 145198389 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | ethane;N-prop-1-en-2-yl-2-[(4-propylpiperazin-1-yl)methyl]prop-2-en-1-imine |
| SMILES | C=C(/C=N/C(=C)C)CN1CCN(CCC)CC1.CC |
| InChI | InChI=1S/C14H25N3.C2H6/c1-5-6-16-7-9-17(10-8-16)12-14(4)11-15-13(2)3;1-2/h11H,2,4-10,12H2,1,3H3;1-2H3/b15-11+; |
| InChIKey | RHZZBVFKLKLUIH-KRWCAOSLSA-N |
| XLogP | 3.20 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|