C16H33N3 — CID 145198109
N-[(Z)-but-2-en-2-yl]-2-(piperazin-1-ylmethyl)prop-2-en-1-imine;ethane (PubChem CID 145198109) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-2-(piperazin-1-ylmethyl)prop-2-en-1-imine;ethane.
| Compound Name | N-[(Z)-but-2-en-2-yl]-2-(piperazin-1-ylmethyl)prop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 145198109 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-2-(piperazin-1-ylmethyl)prop-2-en-1-imine;ethane |
| SMILES | C=C(/C=N/C(C)=C\C)CN1CCNCC1.CC.CC |
| InChI | InChI=1S/C12H21N3.2C2H6/c1-4-12(3)14-9-11(2)10-15-7-5-13-6-8-15;2*1-2/h4,9,13H,2,5-8,10H2,1,3H3;2*1-2H3/b12-4-,14-9+;; |
| InChIKey | HBTNZXONMKJOOQ-XSRGHQNNSA-N |
| XLogP | 3.49 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|