C25H23OP — CID 145199166
1-[[2,3-bis(ethenyl)phenyl]-phenylphosphoryl]-2-ethenyl-3-methylbenzene (PubChem CID 145199166) has the molecular formula C25H23OP and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[[2,3-bis(ethenyl)phenyl]-phenylphosphoryl]-2-ethenyl-3-methylbenzene.
| Compound Name | 1-[[2,3-bis(ethenyl)phenyl]-phenylphosphoryl]-2-ethenyl-3-methylbenzene |
|---|---|
| PubChem CID | 145199166 |
| Molecular Formula | C25H23OP |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[[2,3-bis(ethenyl)phenyl]-phenylphosphoryl]-2-ethenyl-3-methylbenzene |
| SMILES | C=Cc1cccc(P(=O)(c2ccccc2)c2cccc(C)c2C=C)c1C=C |
| InChI | InChI=1S/C25H23OP/c1-5-20-14-12-18-25(23(20)7-3)27(26,21-15-9-8-10-16-21)24-17-11-13-19(4)22(24)6-2/h5-18H,1-3H2,4H3 |
| InChIKey | GFGCTEFAPASMIZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|