C22H29BrFN5O2 — CID 145199468
tert-butyl N-[1-[3-[(6-bromo-5-fluoro-2-pyridinyl)methylamino]-4-pyridinyl]-5-methylpiperidin-3-yl]carbamate (PubChem CID 145199468) has the molecular formula C22H29BrFN5O2 and a molecular weight of 494.41 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[(6-bromo-5-fluoro-2-pyridinyl)methylamino]-4-pyridinyl]-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[(6-bromo-5-fluoro-2-pyridinyl)methylamino]-4-pyridinyl]-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 145199468 |
| Molecular Formula | C22H29BrFN5O2 |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | tert-butyl N-[1-[3-[(6-bromo-5-fluoro-2-pyridinyl)methylamino]-4-pyridinyl]-5-methylpiperidin-3-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CN(c2ccncc2NCc2ccc(F)c(Br)n2)C1 |
| InChI | InChI=1S/C22H29BrFN5O2/c1-14-9-16(28-21(30)31-22(2,3)4)13-29(12-14)19-7-8-25-11-18(19)26-10-15-5-6-17(24)20(23)27-15/h5-8,11,14,16,26H,9-10,12-13H2,1-4H3,(H,28,30) |
| InChIKey | QOIBINDKDZRKHL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|