C16H25FN4O2 — CID 58386800
tert-butyl N-[1-(3-amino-4-pyridinyl)-5-(fluoromethyl)piperidin-3-yl]carbamate (PubChem CID 58386800) has the molecular formula C16H25FN4O2 and a molecular weight of 324.40 g/mol. Its IUPAC name is tert-butyl N-[1-(3-amino-4-pyridinyl)-5-(fluoromethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-amino-4-pyridinyl)-5-(fluoromethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58386800 |
| Molecular Formula | C16H25FN4O2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[1-(3-amino-4-pyridinyl)-5-(fluoromethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(CF)CN(c2ccncc2N)C1 |
| InChI | InChI=1S/C16H25FN4O2/c1-16(2,3)23-15(22)20-12-6-11(7-17)9-21(10-12)14-4-5-19-8-13(14)18/h4-5,8,11-12H,6-7,9-10,18H2,1-3H3,(H,20,22) |
| InChIKey | PUVQSWKHCZFHCS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |