C20H31N3O2 — CID 54580880
tert-butyl 4-(1-pyridin-3-ylpiperidin-4-yl)piperidine-1-carboxylate (PubChem CID 54580880) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl 4-(1-pyridin-3-ylpiperidin-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-pyridin-3-ylpiperidin-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54580880 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | tert-butyl 4-(1-pyridin-3-ylpiperidin-4-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCN(c3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,3)25-19(24)23-13-8-17(9-14-23)16-6-11-22(12-7-16)18-5-4-10-21-15-18/h4-5,10,15-17H,6-9,11-14H2,1-3H3 |
| InChIKey | CRZGKAWVJIDZPZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |