C10H16BF3O2 — CID 145199862
4,4,5,5-tetramethyl-2-(4,4,4-trifluorobut-1-en-2-yl)-1,3,2-dioxaborolane (PubChem CID 145199862) has the molecular formula C10H16BF3O2 and a molecular weight of 236.04 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4,4,4-trifluorobut-1-en-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4,4,4-trifluorobut-1-en-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145199862 |
| Molecular Formula | C10H16BF3O2 |
| Molecular Weight | 236.04 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4,4,4-trifluorobut-1-en-2-yl)-1,3,2-dioxaborolane |
| SMILES | C=C(CC(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H16BF3O2/c1-7(6-10(12,13)14)11-15-8(2,3)9(4,5)16-11/h1,6H2,2-5H3 |
| InChIKey | PAVZTFFDRBZQDM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|