C13H24N2 — CID 145200289
[(2E,3Z)-1-cyclopropyl-2-ethylidenehexa-3,5-dienyl]hydrazine;ethane (PubChem CID 145200289) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is [(2E,3Z)-1-cyclopropyl-2-ethylidenehexa-3,5-dienyl]hydrazine;ethane.
| Compound Name | [(2E,3Z)-1-cyclopropyl-2-ethylidenehexa-3,5-dienyl]hydrazine;ethane |
|---|---|
| PubChem CID | 145200289 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | [(2E,3Z)-1-cyclopropyl-2-ethylidenehexa-3,5-dienyl]hydrazine;ethane |
| SMILES | C=C/C=C\C(=C/C)C(NN)C1CC1.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-3-5-6-9(4-2)11(13-12)10-7-8-10;1-2/h3-6,10-11,13H,1,7-8,12H2,2H3;1-2H3/b6-5-,9-4+; |
| InChIKey | OYRDLKCEOFGIJD-YWPNFKROSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|