C14H15N3OS2 — CID 145201737
acetaldehyde;N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)thiophen-2-amine (PubChem CID 145201737) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is acetaldehyde;N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)thiophen-2-amine.
| Compound Name | acetaldehyde;N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)thiophen-2-amine |
|---|---|
| PubChem CID | 145201737 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | acetaldehyde;N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)thiophen-2-amine |
| SMILES | CC=O.CNc1sc(C)cc1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C12H11N3S2.C2H4O/c1-7-5-8(11(13-2)16-7)12-15-9-6-14-4-3-10(9)17-12;1-2-3/h3-6,13H,1-2H3;2H,1H3 |
| InChIKey | CGJCFKRTUUIINR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|