C15H16N4S2 — CID 145201697
N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-amine (PubChem CID 145201697) has the molecular formula C15H16N4S2 and a molecular weight of 316.46 g/mol. Its IUPAC name is N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-amine.
| Compound Name | N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-amine |
|---|---|
| PubChem CID | 145201697 |
| Molecular Formula | C15H16N4S2 |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N,5-dimethyl-3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-amine |
| SMILES | CNc1sc2c(c1-c1nc3cnccc3s1)CC(C)NC2 |
| InChI | InChI=1S/C15H16N4S2/c1-8-5-9-12(7-18-8)21-14(16-2)13(9)15-19-10-6-17-4-3-11(10)20-15/h3-4,6,8,16,18H,5,7H2,1-2H3 |
| InChIKey | MEDLRTLESRCLGP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |