C23H27N2O2S2+ — CID 158151693
1-[3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one (PubChem CID 158151693) has the molecular formula C23H27N2O2S2+ and a molecular weight of 427.62 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
|---|---|
| PubChem CID | 158151693 |
| Molecular Formula | C23H27N2O2S2+ |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-7-methoxyheptan-2-one |
| SMILES | [CH2+]OCCCCCC(=O)Cc1sc2c(c1-c1nc3ccccc3s1)CC(C)NC2 |
| InChI | InChI=1S/C23H27N2O2S2/c1-15-12-17-21(14-24-15)28-20(13-16(26)8-4-3-7-11-27-2)22(17)23-25-18-9-5-6-10-19(18)29-23/h5-6,9-10,15,24H,2-4,7-8,11-14H2,1H3/q+1 |
| InChIKey | CYGPVXRCAAMHRQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|