C21H23N5O2S2 — CID 159877409
molecular hydrogen;6-(1,2,4-oxadiazol-3-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one (PubChem CID 159877409) has the molecular formula C21H23N5O2S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is molecular hydrogen;6-(1,2,4-oxadiazol-3-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one.
| Compound Name | molecular hydrogen;6-(1,2,4-oxadiazol-3-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one |
|---|---|
| PubChem CID | 159877409 |
| Molecular Formula | C21H23N5O2S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | molecular hydrogen;6-(1,2,4-oxadiazol-3-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one |
| SMILES | O=C(CCCCc1ncon1)Cc1sc2c(c1-c1nc3cnccc3s1)CCNC2.[H][H] |
| InChI | InChI=1S/C21H21N5O2S2.H2/c27-13(3-1-2-4-19-24-12-28-26-19)9-17-20(14-5-7-23-11-18(14)29-17)21-25-15-10-22-8-6-16(15)30-21;/h6,8,10,12,23H,1-5,7,9,11H2;1H |
| InChIKey | NTBXCIYKCZGEDS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|