C23H25N5OS2 — CID 158657365
6-(3-methylimidazol-4-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one (PubChem CID 158657365) has the molecular formula C23H25N5OS2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 6-(3-methylimidazol-4-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one.
| Compound Name | 6-(3-methylimidazol-4-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one |
|---|---|
| PubChem CID | 158657365 |
| Molecular Formula | C23H25N5OS2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 6-(3-methylimidazol-4-yl)-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]hexan-2-one |
| SMILES | Cn1cncc1CCCCC(=O)Cc1sc2c(c1-c1nc3cnccc3s1)CCNC2 |
| InChI | InChI=1S/C23H25N5OS2/c1-28-14-26-11-15(28)4-2-3-5-16(29)10-20-22(17-6-8-25-13-21(17)30-20)23-27-18-12-24-9-7-19(18)31-23/h7,9,11-12,14,25H,2-6,8,10,13H2,1H3 |
| InChIKey | BHGXTJFTEMRFMV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|