About 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane
2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane (PubChem CID 145202085) has the molecular formula C11H11BrN2S
and a molecular weight of 283.19 g/mol. Its IUPAC name is 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane.
Molecular Properties
| Compound Name | 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane |
| PubChem CID | 145202085 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane |
| SMILES | CC.N#CCc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C9H5BrN2S.C2H6/c10-6-1-2-8-7(5-6)12-9(13-8)3-4-11;1-2/h1-2,5H,3H2;1-2H3 |
| InChIKey | YPTUQYLYAQRXCE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane?
The IUPAC name of 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane (CID 145202085) is 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane.
What is the SMILES notation for 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane?
The canonical SMILES for 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane is CC.N#CCc1nc2cc(Br)ccc2s1.
What is the InChIKey of 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane?
The InChIKey is YPTUQYLYAQRXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2S.C2H6/c10-6-1-2-8-7(5-6)12-9(13-8)3-4-11;1-2/h1-2,5H,3H2;1-2H3.
What are the key properties of 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane?
2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane has a molecular weight of 283.19 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1,3-benzothiazol-2-yl)acetonitrile;ethane is sourced from PubChem (CID 145202085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).