C13H8N2S — CID 137477401
2-benzo[f][1,3]benzothiazol-2-ylacetonitrile (PubChem CID 137477401) has the molecular formula C13H8N2S and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-benzo[f][1,3]benzothiazol-2-ylacetonitrile.
| Compound Name | 2-benzo[f][1,3]benzothiazol-2-ylacetonitrile |
|---|---|
| PubChem CID | 137477401 |
| Molecular Formula | C13H8N2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-benzo[f][1,3]benzothiazol-2-ylacetonitrile |
| SMILES | N#CCc1nc2cc3ccccc3cc2s1 |
| InChI | InChI=1S/C13H8N2S/c14-6-5-13-15-11-7-9-3-1-2-4-10(9)8-12(11)16-13/h1-4,7-8H,5H2 |
| InChIKey | LZUUEFNMNVTCOP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |