C22H20F2N2O3 — CID 145203644
4-[(2,3-difluorophenyl)methyl]-N-[[(2R)-2-hydroxycyclopentyl]methylidene]-1,4-benzoxazine-2-carboxamide (PubChem CID 145203644) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methyl]-N-[[(2R)-2-hydroxycyclopentyl]methylidene]-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-[(2,3-difluorophenyl)methyl]-N-[[(2R)-2-hydroxycyclopentyl]methylidene]-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 145203644 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methyl]-N-[[(2R)-2-hydroxycyclopentyl]methylidene]-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(/N=C/C1CCC[C@H]1O)C1=CN(Cc2cccc(F)c2F)c2ccccc2O1 |
| InChI | InChI=1S/C22H20F2N2O3/c23-16-7-3-6-15(21(16)24)12-26-13-20(29-19-10-2-1-8-17(19)26)22(28)25-11-14-5-4-9-18(14)27/h1-3,6-8,10-11,13-14,18,27H,4-5,9,12H2/b25-11+/t14?,18-/m1/s1 |
| InChIKey | KZIQLTUDMWWCQZ-PPNMIXTGSA-N |
| XLogP | 3.96 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|