C29H28F4S — CID 145203811
(2Z)-2-[1-fluoro-2-[4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-propylthiophene (PubChem CID 145203811) has the molecular formula C29H28F4S and a molecular weight of 484.60 g/mol. Its IUPAC name is (2Z)-2-[1-fluoro-2-[4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-propylthiophene.
| Compound Name | (2Z)-2-[1-fluoro-2-[4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-propylthiophene |
|---|---|
| PubChem CID | 145203811 |
| Molecular Formula | C29H28F4S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (2Z)-2-[1-fluoro-2-[4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-propylthiophene |
| SMILES | C=C(/C=C(\F)C(=C)F)C(=C)/C(F)=C\C(=C)C1=CC=C(C(=C)/C(F)=c2/sc(CCC)cc2=C)CC1 |
| InChI | InChI=1S/C29H28F4S/c1-8-9-25-14-19(4)29(34-25)28(33)21(6)24-12-10-23(11-13-24)18(3)16-26(31)20(5)17(2)15-27(32)22(7)30/h10,12,14-16H,2-9,11,13H2,1H3/b26-16+,27-15+,29-28- |
| InChIKey | CMJBBSCCKUNCPO-JIWQZNSCSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|