C29H26F4S — CID 145203823
(2E)-2-[2-[3-fluoro-4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-prop-2-enylthiophene (PubChem CID 145203823) has the molecular formula C29H26F4S and a molecular weight of 482.59 g/mol. Its IUPAC name is (2E)-2-[2-[3-fluoro-4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-prop-2-enylthiophene.
| Compound Name | (2E)-2-[2-[3-fluoro-4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-prop-2-enylthiophene |
|---|---|
| PubChem CID | 145203823 |
| Molecular Formula | C29H26F4S |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (2E)-2-[2-[3-fluoro-4-[(3E,7E)-4,8,9-trifluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]cyclohexa-1,3-dien-1-yl]prop-2-enylidene]-3-methylidene-5-prop-2-enylthiophene |
| SMILES | C=CCc1cc(=C)/c(=C\C(=C)C2=CC(F)=C(C(=C)/C=C(/F)C(=C)C(=C)/C=C(\F)C(=C)F)CC2)s1 |
| InChI | InChI=1S/C29H26F4S/c1-8-9-24-12-20(5)29(34-24)15-18(3)23-10-11-25(28(33)16-23)19(4)14-26(31)21(6)17(2)13-27(32)22(7)30/h8,12-16H,1-7,9-11H2/b26-14+,27-13+,29-15+ |
| InChIKey | YSAFFQKASGJQCT-SCBGYYMTSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|