C22H30N6O — CID 145204373
8-[[4-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 145204373) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 8-[[4-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-[[4-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 145204373 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 8-[[4-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | C/C(N)=C/C=C(\N)N1CCN(Cc2ccc3c4c(c(=O)[nH]c3c2)CCCN4)CC1 |
| InChI | InChI=1S/C22H30N6O/c1-15(23)4-7-20(24)28-11-9-27(10-12-28)14-16-5-6-17-19(13-16)26-22(29)18-3-2-8-25-21(17)18/h4-7,13,25H,2-3,8-12,14,23-24H2,1H3,(H,26,29)/b15-4-,20-7+ |
| InChIKey | SJXZQQOMAZAVME-ILNLXZNKSA-N |
| XLogP | 1.67 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|