C25H30N6O — CID 145204389
8-[[4-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 145204389) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 8-[[4-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-[[4-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 145204389 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 8-[[4-[4-methyl-3-(2-methylidenehydrazinyl)phenyl]piperazin-1-yl]methyl]-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | C=NNc1cc(N2CCN(Cc3ccc4c5c(c(=O)[nH]c4c3)CCCN5)CC2)ccc1C |
| InChI | InChI=1S/C25H30N6O/c1-17-5-7-19(15-22(17)29-26-2)31-12-10-30(11-13-31)16-18-6-8-20-23(14-18)28-25(32)21-4-3-9-27-24(20)21/h5-8,14-15,27,29H,2-4,9-13,16H2,1H3,(H,28,32) |
| InChIKey | YYEMPXVCTGVTBD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|