C18H17NO4 — CID 145204958
6-(hydroxymethoxy)-5-(2-pyridin-2-ylethyl)naphthalene-1,2-diol (PubChem CID 145204958) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 6-(hydroxymethoxy)-5-(2-pyridin-2-ylethyl)naphthalene-1,2-diol.
| Compound Name | 6-(hydroxymethoxy)-5-(2-pyridin-2-ylethyl)naphthalene-1,2-diol |
|---|---|
| PubChem CID | 145204958 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 6-(hydroxymethoxy)-5-(2-pyridin-2-ylethyl)naphthalene-1,2-diol |
| SMILES | OCOc1ccc2c(O)c(O)ccc2c1CCc1ccccn1 |
| InChI | InChI=1S/C18H17NO4/c20-11-23-17-9-7-15-13(6-8-16(21)18(15)22)14(17)5-4-12-3-1-2-10-19-12/h1-3,6-10,20-22H,4-5,11H2 |
| InChIKey | ZKVRONRQGSDBPK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|