C19H12Cl2F3NO2 — CID 145206605
[2,6-dichloro-3-(1-hydroxyethenyl)phenyl]-[7-methyl-5-(trifluoromethyl)indol-1-yl]methanone (PubChem CID 145206605) has the molecular formula C19H12Cl2F3NO2 and a molecular weight of 414.21 g/mol. Its IUPAC name is [2,6-dichloro-3-(1-hydroxyethenyl)phenyl]-[7-methyl-5-(trifluoromethyl)indol-1-yl]methanone.
| Compound Name | [2,6-dichloro-3-(1-hydroxyethenyl)phenyl]-[7-methyl-5-(trifluoromethyl)indol-1-yl]methanone |
|---|---|
| PubChem CID | 145206605 |
| Molecular Formula | C19H12Cl2F3NO2 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | [2,6-dichloro-3-(1-hydroxyethenyl)phenyl]-[7-methyl-5-(trifluoromethyl)indol-1-yl]methanone |
| SMILES | C=C(O)c1ccc(Cl)c(C(=O)n2ccc3cc(C(F)(F)F)cc(C)c32)c1Cl |
| InChI | InChI=1S/C19H12Cl2F3NO2/c1-9-7-12(19(22,23)24)8-11-5-6-25(17(9)11)18(27)15-14(20)4-3-13(10(2)26)16(15)21/h3-8,26H,2H2,1H3 |
| InChIKey | BCKROIDYGUATHF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|