C18H11ClF3NO3 — CID 174890384
2-chloro-3-[7-methyl-5-(trifluoromethyl)indole-1-carbonyl]benzoic acid (PubChem CID 174890384) has the molecular formula C18H11ClF3NO3 and a molecular weight of 381.74 g/mol. Its IUPAC name is 2-chloro-3-[7-methyl-5-(trifluoromethyl)indole-1-carbonyl]benzoic acid.
| Compound Name | 2-chloro-3-[7-methyl-5-(trifluoromethyl)indole-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 174890384 |
| Molecular Formula | C18H11ClF3NO3 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-chloro-3-[7-methyl-5-(trifluoromethyl)indole-1-carbonyl]benzoic acid |
| SMILES | Cc1cc(C(F)(F)F)cc2ccn(C(=O)c3cccc(C(=O)O)c3Cl)c12 |
| InChI | InChI=1S/C18H11ClF3NO3/c1-9-7-11(18(20,21)22)8-10-5-6-23(15(9)10)16(24)12-3-2-4-13(14(12)19)17(25)26/h2-8H,1H3,(H,25,26) |
| InChIKey | SFIJTVDTRATWTQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |